5-alpha-cholesta-8,24-dien-3-beta-ol manufacturers
- Zymosterol
-
- $568.00 / 1mg
-
2026-01-05
- CAS:128-33-6
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 5-alpha-cholesta-8,24-dien-3-beta-ol Basic information |
| Product Name: | 5-alpha-cholesta-8,24-dien-3-beta-ol | | Synonyms: | 5-alpha-cholesta-8,24-dien-3-beta-ol;(3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;zymosterol intermediate 2;5α-Cholesta-8,24-dien-3β-ol;C05437;delta8,24-Cholestadien-3beta-ol;5Α-CHOLESTA-8,24-DIEN-3-OL;ZYMOSTEROL;Cholesta-8,24-dien-3-ol, (3β,5α)- | | CAS: | 128-33-6 | | MF: | C27H44O | | MW: | 384.63766 | | EINECS: | 204-880-9 | | Product Categories: | | | Mol File: | 128-33-6.mol |  |
| | 5-alpha-cholesta-8,24-dien-3-beta-ol Chemical Properties |
| Melting point | 110°C | | Boiling point | 451.27°C (rough estimate) | | density | 0.9717 (rough estimate) | | refractive index | 1.5100 (estimate) | | storage temp. | -70°C | | solubility | soluble in No data available | | pka | 15.12±0.70(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | +4920 (c 1, CHCl3) | | InChIKey | CGSJXLIKVBJVRY-XTGBIJOFSA-N | | SMILES | O[C@@H]1C[C@H]2[C@](CC1)(C3=C([C@H]4[C@@]([C@H](CC4)[C@@H](CCC=C(C)C)C)(CC3)C)CC2)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-alpha-cholesta-8,24-dien-3-beta-ol Usage And Synthesis |
| Uses | Zymosterol is an sterol intermediate in the biosynthesis of cholesterol (C432501). Cholesterol is a major component of all biological membranes; ~25% of total brain lipid is Cholesterol. Zymosterol was also found to be located in the plasma membrane of cultured human fibroblasts via labeling studies. | | Definition | ChEBI: Zymosterol is a cholestanoid and a 3beta-sterol. It has a role as a human metabolite, a Saccharomyces cerevisiae metabolite and a mouse metabolite. It derives from a hydride of a 5alpha-cholestane. | | IC 50 | Human Endogenous Metabolite |
| | 5-alpha-cholesta-8,24-dien-3-beta-ol Preparation Products And Raw materials |
|