|
|
| | Lincomycin hydrochloride monohydrate Basic information |
| | Lincomycin hydrochloride monohydrate Chemical Properties |
| Melting point | 156-158° | | alpha | D25 +143° (water) | | storage temp. | Sealed in dry,2-8°C | | solubility | Very soluble in water, slightly soluble in ethanol (96 per cent), very slightly soluble in acetone. | | form | Solid | | color | White to Almost white | | Merck | 14,5500 | | Major Application | clinical testing | | InChIKey | LFZGYTBWUHCAKF-DCNJEFSFSA-N | | SMILES | Cl[H].[H]O[H].CCC[C@@H]1C[C@H](N(C)C1)C(=O)N[C@H]([C@@H](C)O)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O | | CAS DataBase Reference | 7179-49-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-24/25 | | WGK Germany | 2 | | RTECS | RH6315500 | | HS Code | 29419090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Lincomycin hydrochloride monohydrate Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder. | | Uses | antibacterial | | Brand name | Lincocin (Pharmacia & Upjohn). | | Contact allergens | Lincomycin is an antibiotic of the lincosanide group，active against Gram-positive bacteria. Occupational
exposure occurs in poultry and pig breeders | | in vivo | Lincomycin (25 and 50 mg/kg, intravenously) depresses neuromuscular transmission to a degree which depended on stimulation frequencies in the rabbit sciatic nerve-gastrocnemius muscle preparation[3].
| Animal Model: | Adult albino New Zealand rabbits weighing 2.5-3.5 kg[3]. | | Dosage: | 25 and 50 mg/kg. | | Administration: | Intravenously. | | Result: | Depressed neuromuscular transmission. |
|
| | Lincomycin hydrochloride monohydrate Preparation Products And Raw materials |
|