4-DECANOL manufacturers
- 4-DECANOL
-
- $0.00 / 25KG
-
2024-03-28
- CAS:2051-31-2
- Min. Order: 25KG
- Purity: ≥95%
- Supply Ability: Inquiry
|
| | 4-DECANOL Basic information |
| Product Name: | 4-DECANOL | | Synonyms: | 4-DECYL ALCOHOL;4-DECANOL, 97+%;Hexylpropylcarbinol;decan-4-ol;Decane-4-ol;4-Decanol,99%;4-Decyl Alcohol
Hexylpropylcarbinol;1-Propylheptyl alcohol | | CAS: | 2051-31-2 | | MF: | C10H22O | | MW: | 158.28 | | EINECS: | 218-117-2 | | Product Categories: | | | Mol File: | 2051-31-2.mol |  |
| | 4-DECANOL Chemical Properties |
| Melting point | -11.4°C | | Boiling point | 210-211 °C | | density | 0.82 | | refractive index | 1.431-1.433 | | Fp | 82 °C | | form | clear liquid | | pka | 15.44±0.20(Predicted) | | color | Colorless to Light yellow | | BRN | 1735252 | | InChI | InChI=1S/C10H22O/c1-3-5-6-7-9-10(11)8-4-2/h10-11H,3-9H2,1-2H3 | | InChIKey | DTDMYWXTWWFLGJ-UHFFFAOYSA-N | | SMILES | CCCC(O)CCCCCC | | LogP | 3.740 (est) | | CAS DataBase Reference | 2051-31-2(CAS DataBase Reference) |
| | 4-DECANOL Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID |
| | 4-DECANOL Preparation Products And Raw materials |
|