|
|
| | 4-PHENYL-3-THIOSEMICARBAZIDE Basic information |
| | 4-PHENYL-3-THIOSEMICARBAZIDE Chemical Properties |
| Melting point | 138-140 °C (lit.) | | Boiling point | 287.4±23.0 °C(Predicted) | | density | 1.1960 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | methanol: 50 mg/mL, clear | | form | powder to crystal | | pka | 11.01±0.70(Predicted) | | color | White to Almost white | | BRN | 608285 | | InChI | InChI=1S/C7H9N3S/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) | | InChIKey | KKIGUVBJOHCXSP-UHFFFAOYSA-N | | SMILES | N(C(NC1=CC=CC=C1)=S)N | | CAS DataBase Reference | 5351-69-9(CAS DataBase Reference) | | EPA Substance Registry System | Hydrazinecarbothioamide, N-phenyl- (5351-69-9) |
| Hazard Codes | T,Xi | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | VT4025000 | | Hazard Note | Harmful | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29309090 |
| | 4-PHENYL-3-THIOSEMICARBAZIDE Usage And Synthesis |
| Chemical Properties | white to slightly yellow fine crystalline powder | | Uses | 4-Phenylthiosemicarbazide was used in the synthesis of amberlite XAD resins. It was also used in the synthesis of a series of thiosemicarbazones. | | Purification Methods | Crystallise it from EtOH. [Beilstein 12 IV 827.] |
| | 4-PHENYL-3-THIOSEMICARBAZIDE Preparation Products And Raw materials |
|