4-Chloro-6-methoxy-2-(methylthio)pyrimidine manufacturers
|
| | 4-Chloro-6-methoxy-2-(methylthio)pyrimidine Basic information |
| Product Name: | 4-Chloro-6-methoxy-2-(methylthio)pyrimidine | | Synonyms: | 4-Chloro-6-methoxy-2-(methylthio)pyrimidine ,98%;4-CHLORO-6-METHOXY-2-(METHYLTHIO)PYRIMIDINE;4-Chloro-6-methoxy-2-(methylthio);Pyrimidine, 4-chloro-6-methoxy-2-(methylthio)-;6-methoxy-2-methylthio-4-chlorpyrimidine | | CAS: | 89466-42-2 | | MF: | C6H7ClN2OS | | MW: | 190.65 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 89466-42-2.mol |  |
| | 4-Chloro-6-methoxy-2-(methylthio)pyrimidine Chemical Properties |
| Melting point | 38-39℃ | | Boiling point | 288℃ | | density | 1.36 | | refractive index | 1. | | Fp | 128℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.26±0.30(Predicted) | | InChI | InChI=1S/C6H7ClN2OS/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 | | InChIKey | FNYLFWGITLMOHA-UHFFFAOYSA-N | | SMILES | C1(SC)=NC(OC)=CC(Cl)=N1 |
| Risk Statements | 22 | | Safety Statements | 36/37 | | HS Code | 29335990 |
| | 4-Chloro-6-methoxy-2-(methylthio)pyrimidine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 4-chloro-6-methoxy-2-(methylthio)pyrimidine is a versatile scaffold and can undergo Suzuki-Miyaura coupling to afford 4-aryl-6-methoxy-2-(methylthio)pyrimidines, as well as amine or alcohol displacement of the chloride, oxidation to sulfone, and condensation reactions to give polycyclic systems][1].
| | References | [1] A. Kalogirou, P. Koutentis. “4-Chloro-6-ethoxy-2-(methylthio)pyrimidine.” Molbank 2017 1 (2016). |
| | 4-Chloro-6-methoxy-2-(methylthio)pyrimidine Preparation Products And Raw materials |
|