- α-Dihydroartemisinin
-
- $50.00 / 1mL
-
2025-10-26
- CAS:81496-81-3
- Min. Order:
- Purity: ≥98%
- Supply Ability: 10g
|
| | alpha-Dihydroartemisinin Basic information |
| Product Name: | alpha-Dihydroartemisinin | | Synonyms: | alpha-dihydroartemisinin;artenimol;dhqhs 1;(3R,5aS,6R,8aS,9R,10R,12R,12aR)-Decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-ol;Artenimol [inn];BDIH;DihydroarteMisinin (α,β Mixture);dihdyroartesiminin | | CAS: | 81496-81-3 | | MF: | C15H24O5 | | MW: | 284.35 | | EINECS: | 617-239-7 | | Product Categories: | API | | Mol File: | 81496-81-3.mol |  |
| | alpha-Dihydroartemisinin Chemical Properties |
| Melting point | 142-144°C | | Boiling point | 375.6±42.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.61±0.70(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C15H24O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-13,16H,4-7H2,1-3H3/t8-,9-,10+,11+,12-,13-,14-,15-/m1/s1 | | InChIKey | BJDCWCLMFKKGEE-KDTBHNEXSA-N | | SMILES | O1[C@]23[C@@]4([H])O[C@@](C)(CC[C@@]2([H])[C@H](C)CC[C@@]3([H])[C@@H](C)[C@H](O)O4)O1 |
| | alpha-Dihydroartemisinin Usage And Synthesis |
| Chemical Properties | White needle like crystal | | Uses | antimalarial, antiinflammatory | | Definition | ChEBI: Dihydroartemisinin (DHA) is an artemisinin derivative. | | target | Antifection |
| | alpha-Dihydroartemisinin Preparation Products And Raw materials |
| Raw materials | DHQHS 2-->Artemisinin | | Preparation Products | (3R,12aR)-3,6α,9β-Trimethyl-3β,12α-epoxy-3,4,5,5aα,6,7,8,8aα,9,10-decahydro-10α-ethoxypyrano[4,3-j]-1,2-benzodioxepin-->Arteether-->Artesunate |
|