- 4-Chloro-2-nitrobenzoic acid
-
- $5.00 / 1KG
-
2025-09-25
- CAS:6280-88-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Chloro-2-nitrobenzoic acid Basic information | | Application |
| | 4-Chloro-2-nitrobenzoic acid Chemical Properties |
| Melting point | 141-143 °C (lit.) | | Boiling point | 160.5°C (rough estimate) | | density | 1.5 | | refractive index | 1.6000 (estimate) | | Fp | >100°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | 5.3g/l | | pka | 1.97±0.25(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | 0.53 g/100 mL (15 ºC) | | BRN | 2051370 | | InChI | 1S/C7H4ClNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) | | InChIKey | JAHIPDTWWVYVRV-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(Cl)cc1[N+]([O-])=O | | CAS DataBase Reference | 6280-88-2(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Chloro-2-nitrobenzoic acid(6280-88-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Chloro-2-nitrobenzoic acid Usage And Synthesis |
| Application | 4-Chloro-2-nitrobenzoic acid, also known as p-chloro-o-nitrobenzoic acid, is an important organic intermediate used in the production of pesticides, pharmaceuticals, dyes, and many other products. 4-Chloro-2-nitrobenzoic acid can be obtained by the oxidation of 4-chloro-2-nitrotoluene. | | Chemical Properties | light yellow to light yellow-green crystalline |
| | 4-Chloro-2-nitrobenzoic acid Preparation Products And Raw materials |
|