|
|
| | 4-Phenylaminobenzaldehyde Basic information |
| Product Name: | 4-Phenylaminobenzaldehyde | | Synonyms: | 4-Phenylaminobenzaldehyde;Benzaldehyde, 4-(phenylamino)-;4-(Phenylamino)Benzaldehyde(WXC00744);4-PHENYLAMINOBENZALD;4-anilinobenzaldehyde | | CAS: | 100727-07-9 | | MF: | C13H11NO | | MW: | 197.23 | | EINECS: | | | Product Categories: | | | Mol File: | 100727-07-9.mol |  |
| | 4-Phenylaminobenzaldehyde Chemical Properties |
| Melting point | 296-297 °C | | Boiling point | 363.1±25.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | -1.96±0.20(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C13H11NO/c15-10-11-6-8-13(9-7-11)14-12-4-2-1-3-5-12/h1-10,14H | | InChIKey | XXWHZIJHYNPASE-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| | 4-Phenylaminobenzaldehyde Usage And Synthesis |
| | 4-Phenylaminobenzaldehyde Preparation Products And Raw materials |
|