|
|
| | 4,4'-Bis(acryloyl)biphenyl Basic information |
| Product Name: | 4,4'-Bis(acryloyl)biphenyl | | Synonyms: | 4,4'-Bis(acryloyl)biphenyl;2-Propenoic acid, 1,1'-[1,1'-biphenyl]-4,4'-diyl ester;4'-(((vinyloxy)carbonyl)oxy)-[1,1'-biphenyl]-4-yl acrylate;1,1'-biphenyl]-4,4'-diyl diacrylate;1,1′-[1,1′-Biphenyl]-4,4′-diyl di-2-propenoate;4,4'-Biphenyl diacrylate;[1,1'-Biphenyl]-4,4'-diyl diacrylate - [B92304] | | CAS: | 84948-17-4 | | MF: | C18H14O4 | | MW: | 294.3 | | EINECS: | | | Product Categories: | | | Mol File: | 84948-17-4.mol |  |
| | 4,4'-Bis(acryloyl)biphenyl Chemical Properties |
| Boiling point | 457.7±25.0 °C(Predicted) | | density | 1.162±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H14O4/c1-3-17(19)21-15-9-5-13(6-10-15)14-7-11-16(12-8-14)22-18(20)4-2/h3-12H,1-2H2 | | InChIKey | OVCJXJDRQQBETG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OC(=O)C=C)C=C2)=CC=C(OC(=O)C=C)C=C1 |
| | 4,4'-Bis(acryloyl)biphenyl Usage And Synthesis |
| Chemical Properties | White Powder |
| | 4,4'-Bis(acryloyl)biphenyl Preparation Products And Raw materials |
|