| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Umicore M71 SIMes Basic information |
| Product Name: | Umicore M71 SIMes | | Synonyms: | Umicore M71 SIMes;UMicore M71 SIMes, 13% Ru, Product of UMicore;Dichloro[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene][(2-isopropoxy)(5-trifluoroacetamido)benzylidene]ruthenium(II);Dichloro(1,3-dimesityl-2-imidazolidinylidene){2-isopropoxy-5-[(trifluoroacetyl)amino]benzylidene}ruthenium;[1,3-Bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[(2-isopropoxy)(5-trifluoroacetamido)benzylidene]ruthenium(II);(SP-5-41)-[1,3-Bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro[[2-(1-methylethoxy-κO)-5-[(2,2,2-trifluoroacetyl)amino]phenyl]methylene-κC]ruthenium;Hoveyda-Grubbs Catalyst? M710;Hoveyda-Grubbs Catalyst? M710 | | CAS: | 1025728-56-6 | | MF: | C33H37Cl2F3N3O2Ru | | MW: | 736.64 | | EINECS: | | | Product Categories: | | | Mol File: | 1025728-56-6.mol |  |
| | Umicore M71 SIMes Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | InChIKey | TUXRUOWNSPNNTK-UHFFFAOYSA-L | | SMILES | CC(C)OC1=C(C=C(NC(C(F)(F)F)=O)C=C1)C=[Ru](Cl)(Cl)=C2N(C3=C(C)C=C(C)C=C3C)CCN2C4=C(C)C=C(C)C=C4C |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36/38 | | Safety Statements | 26 | | RIDADR | UN1325 - class 4.1 - PG 3 - Flammable solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | HS Code | 28439000 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Irrit. 2
Flam. Sol. 2
Skin Irrit. 2 |
| | Umicore M71 SIMes Usage And Synthesis |
| reaction suitability | core: ruthenium
reagent type: catalyst |
| | Umicore M71 SIMes Preparation Products And Raw materials |
|