|
|
| | Benzo[b]benzo[4,5]thieno[2,3-d]thiophene Basic information |
| Product Name: | Benzo[b]benzo[4,5]thieno[2,3-d]thiophene | | Synonyms: | Benzo[b]benzo[4,5]thieno[2,3-d]thiophene;benzthieno[3,2-b]benzothiophene;[1]benzothiolo[3,2-b][1]benzothiole;Benzo[b]benzo[4,5]thieno[2,3-d]thiophene - BTBT;BTBT;3-d]thiophene;Benzo[b]benzo[4;[1]Benzothiopheno[3,2-b][1]benzothiophene | | CAS: | 248-70-4 | | MF: | C14H8S2 | | MW: | 240.34 | | EINECS: | | | Product Categories: | | | Mol File: | 248-70-4.mol | ![Benzo[b]benzo[4,5]thieno[2,3-d]thiophene Structure](CAS/GIF/248-70-4.gif) |
| | Benzo[b]benzo[4,5]thieno[2,3-d]thiophene Chemical Properties |
| Melting point | 218.0 to 222.0 °C | | Boiling point | 432.3±18.0 °C(Predicted) | | density | 1.407±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Yellow to Green | | λmax | 332nm(Toluene)(lit.) | | InChI | InChI=1S/C14H8S2/c1-3-7-11-9(5-1)13-14(15-11)10-6-2-4-8-12(10)16-13/h1-8H | | InChIKey | NXCSDJOTXUWERI-UHFFFAOYSA-N | | SMILES | C12C3=CC=CC=C3SC=1C1=CC=CC=C1S2 |
| | Benzo[b]benzo[4,5]thieno[2,3-d]thiophene Usage And Synthesis |
| | Benzo[b]benzo[4,5]thieno[2,3-d]thiophene Preparation Products And Raw materials |
|