|
|
| | 2-Chloro-6-iodo-3-pivalamidoisonicotinic acid Basic information |
| | 2-Chloro-6-iodo-3-pivalamidoisonicotinic acid Chemical Properties |
| Boiling point | 552.8±50.0 °C(Predicted) | | density | 1.805±0.06 g/cm3(Predicted) | | form | solid | | pka | 1.96±0.10(Predicted) | | InChI | 1S/C11H12ClIN2O3/c1-11(2,3)10(18)15-7-5(9(16)17)4-6(13)14-8(7)12/h4H,1-3H3,(H,15,18)(H,16,17) | | InChIKey | SQTRSSAQBJDIFE-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(=O)Nc1c(Cl)nc(I)cc1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-6-iodo-3-pivalamidoisonicotinic acid Usage And Synthesis |
| | 2-Chloro-6-iodo-3-pivalamidoisonicotinic acid Preparation Products And Raw materials |
|