- 1,2,4,5-Tetrabromobenzene
-
- $5.00 / 1KG
-
2025-09-25
- CAS:636-28-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1,2,4,5-TETRABROMOBENZENE Basic information |
| Product Name: | 1,2,4,5-TETRABROMOBENZENE | | Synonyms: | 1,2,4,5-TETRABROMOBENZENE;1,2,4,5-tetrabromo-benzen;Benzene,1,2,4,5-tetrabromo-;I,2,4,5-Tetrabrombenzol;TETRABROMOBENZENE;1,2,4,5-Tetrabromobenzene,97%;1,2,4,5-TetrabroMobenzene, 97% 25GR;NSC 27002 | | CAS: | 636-28-2 | | MF: | C6H2Br4 | | MW: | 393.7 | | EINECS: | 211-253-3 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives;Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 636-28-2.mol |  |
| | 1,2,4,5-TETRABROMOBENZENE Chemical Properties |
| Melting point | 180-182 °C (lit.) | | Boiling point | 277.95°C (rough estimate) | | density | 3,072 g/cm3 | | refractive index | 1.6303 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in alcohol, benzene, and ether (Weast, 1986) | | form | Crystalline Powder, Crystals or Needles | | color | Beige to brown | | Water Solubility | Insoluble in water. | | BRN | 1365830 | | Stability: | Light Sensitive | | InChI | InChI=1S/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H | | InChIKey | QCKHVNQHBOGZER-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(Br)=C(Br)C=C1Br | | CAS DataBase Reference | 636-28-2(CAS DataBase Reference) | | EPA Substance Registry System | 1,2,4,5-Tetrabromobenzene (636-28-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29039990 |
| | 1,2,4,5-TETRABROMOBENZENE Usage And Synthesis |
| Chemical Properties | brown crystalline needles | | Uses | 1,2,4,5-Tetrabromobenzene is a useful synthetic intermediate. It is used as a building block to prepare various aryl containing compounds such as tetrabenzanthracene, substituted pentacenes [pentacene (P237770)], n-stacking tetracene (N377650) derivatives and so on. | | General Description | The single structure of 1,2,4,5-tetrabromobenzene as actuating elements was studied and the relations between their mechanical properties and kinematic profile were determined. | | Environmental fate | Chemical/Physical. 1,2,4,5-Tetrabromobenzene (150 mg in 250-mL distilled water) was stirred
in the dark for 1 day. GC analysis of the solution showed 1,2,4-tribromobenzene as a major
transformation product (Kim and Saleh, 1990). |
| | 1,2,4,5-TETRABROMOBENZENE Preparation Products And Raw materials |
|