- Ginkgolide K
-
- $80.00 / 5mg
-
2026-01-15
- CAS:153355-70-5
- Min. Order:
- Purity: 99.44%
- Supply Ability: 10g
- Ginkgolide K
-
- $0.00 / 20mg
-
2023-02-24
- CAS:153355-70-5
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Ginkgolide K Basic information |
| Product Name: | Ginkgolide K | | Synonyms: | 9H-1,7a-(Epoxymethano)-1H,6aH-cyclopenta[c]furo[2,3-b]furo[3',2':3,4]cyclopenta[1,2-d]furan-5,9,12(4H)-trione, 3-(1,1-dimethylethyl)-2,3,10a,11-tetrahydro-4,11-dihydroxy-8-methyl-, (1R,3S,3aS,4R,6aR,7aS,10aR,11R,11aR)-;(1R,3S,3aS,4R,6aR,7aS,10aR,11R,11aR)-3-(1,1-Dimethylethyl)-2,3,10a,11-tetrahydro-4,11-dihydroxy-8-methyl-9H-1,7a-(epoxymethano)-1H,6aH-cyclopenta[c]furo[2,3-b]furo[3′,2′:3,4]cyclopenta[1,2-d]furan-5,9,12(4H)-trione;Ginkgolide K, 10 mM in DMSO | | CAS: | 153355-70-5 | | MF: | C20H22O9 | | MW: | 406.39 | | EINECS: | | | Product Categories: | | | Mol File: | 153355-70-5.mol |  |
| | Ginkgolide K Chemical Properties |
| Boiling point | 743.5±60.0 °C(Predicted) | | density | 1.60±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 10 mM | | form | A solid | | pka | 12.10±0.70(Predicted) | | color | White to off-white | | InChIKey | MGXAKXRVQRODDX-ZWQOWFJDNA-N | | SMILES | O[C@H]1[C@]2([H])OC(=O)C(C)=C2C23C(=O)O[C@]4([H])C[C@@H](C(C)(C)C)C5([C@H](C(=O)O[C@@]5([H])O2)O)C134 |&1:1,2,14,17,23,27,r| |
| | Ginkgolide K Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Ginkgo biloba L.. | | Uses | Used for content determination/identification/pharmacological experiments, etc. | | Biological Activity | Ginkgolide K, isolated from Ginkgo biloba, induces protective autophagy through the AMPK/mTOR/ULK1 signaling pathway. It has neuroprotective activity. |
| | Ginkgolide K Preparation Products And Raw materials |
|