- Thymolphthalein
-
- $999.00
-
2026-06-15
- CAS:125-20-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 5000
- Thymolphthalein
-
- $5.00
-
2026-05-28
- CAS:125-20-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
- Thymolphthalein
-
- $132.00
-
2026-05-15
- CAS:125-20-2
- Min. Order: 25Kg/Bag
- Purity: 98%
- Supply Ability: 1-10mt
|
| | Thymolphthalein Basic information |
| Product Name: | Thymolphthalein | | Synonyms: | 3,3-bis(4-hydroxy-2-methyl-5-(1-methylethyl)phenyl)-1(3H)-Isobenzofuranone;3,3-bis[4-hydroxy-2-methyl-5-(1-methylethyl)phenyl]-1(3h)-isobenzofuranon;Thymolphthalein, for analysis ACS;Thymolphthalein, indicator, pure;THYMOLPHTHALEIN REAGENT (ACS);THYMOLPHTHALEIN SOLUTION, 0.05%;1(3H)-Isobenzofuranone, 3,3-bis4-hydroxy-2-methyl-5-(1-methylethyl)phenyl-;Thymolphthalein, Reagent | | CAS: | 125-20-2 | | MF: | C28H30O4 | | MW: | 430.54 | | EINECS: | 204-729-7 | | Product Categories: | Miscellaneous Biochemicals;Analytical Chemistry;Indicator (pH);pH Indicators;Phthalein | | Mol File: | 125-20-2.mol |  |
| | Thymolphthalein Chemical Properties |
| Melting point | 251-253 °C(lit.) | | Boiling point | 504.79°C (rough estimate) | | density | 0.92 g/mL at 25 °C | | bulk density | 400kg/m3 | | vapor pressure | 0.002Pa at 90℃ | | refractive index | 1.6400 (estimate) | | Fp | 74 °F | | storage temp. | no restrictions. | | solubility | ethanol: clarity passes test | | form | Low Melting Mass | | pka | 9.70, 10.0(at 25℃) | | color | White to slightly yellow | | Specific Gravity | 0.92 | | PH | 8.6~10.5 | | PH Range | 9.3(colourless)-10.5(blue) | | Odor | Mild characteristic odor | | explosive limit | 3.30-19% | | Water Solubility | insoluble | | λmax | 592nm, 396nm, 598nm | | Merck | 14,9401 | | BRN | 359413 | | Major Application | Display device, semiconductors, recording materials, photoconductors, sol-gel matrix, tin electroplating process, counterfeit-proof paper, authentication system forsecure documents, inks, pencil leads, correction fluid, paints, petroleum marker, tennis ball, adhesives, floor coatings, textiles, detergents, insecticide, lotion, cleaning pads, food storage, determine bacterial growth, Streptococci in saliva, dental impressionmaterials | | InChI | 1S/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 | | InChIKey | GRBHJPCWQRVGND-UHFFFAOYSA-N | | SMILES | CC(C)c1cc(c(C)cc1O)C2(OC(=O)c3ccccc23)c4cc(C(C)C)c(O)cc4C | | LogP | 3.682 at 25℃ | | CAS DataBase Reference | 125-20-2(CAS DataBase Reference) | | EPA Substance Registry System | Thymolphthalein (125-20-2) |
| Hazard Codes | F,Xn | | Risk Statements | 11-40-10 | | Safety Statements | 7-16-36/37-24/25-22 | | RIDADR | UN 1170 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29322980 | | Storage Class | 11 - Combustible Solids |
| | Thymolphthalein Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | Thymolphthalein is a pH sensitive dye that has multiple uses such as testing hydration and/or saliva testing. | | Uses | As pH indicator: colorless 9.3 to blue 10.5. Also as reagent for blood after decolorizing the alkaline solution by boiling with zinc dust. | | Definition | ChEBI: Thymophthalein is a terpene lactone. | | General Description | Thymolphthalien is an acid-base indicator which is colourless in acidic form and deep blue in basic form. Acidic form retains hydrogen on each hydroxyl group. It is suitable in preparing disappearing ink. | | Synthesis | Made by reacting thymol with phthalic anhydride.
|
| | Thymolphthalein Preparation Products And Raw materials |
|