|
|
| | 3,4-DINITROPHENOL Basic information |
| Product Name: | 3,4-DINITROPHENOL | | Synonyms: | 3,4-dinitrofenol;3,4-dinitro-pheno;3,4-dnp;6,5-dinitrophenol;Phenol, 3,4-dinitro-;3,4-DINITROPHENOL;3,4-dinitrophenol moistened with water (H2O ~20%);3,4-Dinitrophenol Moistened with water, >=97.0% (HPLC) | | CAS: | 577-71-9 | | MF: | C6H4N2O5 | | MW: | 184.11 | | EINECS: | 209-415-3 | | Product Categories: | Aromatic Phenols;Organic Building Blocks;Oxygen Compounds;Phenols;Building Blocks;C6 to C8;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Nitro | | Mol File: | 577-71-9.mol |  |
| | 3,4-DINITROPHENOL Chemical Properties |
| Melting point | 130-135 °C | | Boiling point | 318.03°C (rough estimate) | | density | 1.6720 | | refractive index | 1.4738 (estimate) | | solubility | dioxane: soluble1g/10 mL | | pka | 5.35, 5.42(at 25℃) | | color | Light yellow needles | | PH Range | Colorless (4.3) to yellow (6.3) | | BRN | 1969398 | | Major Application | Lubricants, enzyme assay, antinerve agent, substrate for enzymes, in biotechnological process, for biosensor design | | InChI | 1S/C6H4N2O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H | | InChIKey | AKLOLDQYWQAREW-UHFFFAOYSA-N | | SMILES | Oc1ccc(c(c1)[N+]([O-])=O)[N+]([O-])=O |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-33-51/53 | | Safety Statements | 28-37-45-61 | | RIDADR | UN 1320 4.1/PG 1 | | WGK Germany | 3 | | RTECS | SL3000000 | | HazardClass | 4.1 | | PackingGroup | I | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
Expl. 1.1
STOT RE 2 |
| | 3,4-DINITROPHENOL Usage And Synthesis |
| Chemical Properties | Colorless needles, flammable. Very soluble in ethanol and ether. | | Uses | The effect of pH, ionic strength, and compd. concn. on the liposome-water distribution ratio has been investigated for 3,4-Dinitrophenol. | | Definition | ChEBI: 3,4-dinitrophenol is a dinitrophenol. | | General Description | 3,4-Dinitrophenol is a nitrophenol derivative. | | Purification Methods | Steam distil and crystallise it from H2O then dry it in air. EXPLOSIVE when dry, store it with 10% H2O. [Beilstein 6 III 868, 6 IV 1384.] |
| | 3,4-DINITROPHENOL Preparation Products And Raw materials |
|