|
|
| | 4-((2-Hydroxyethyl)(methyl)amino)benzaldehyde Basic information |
| | 4-((2-Hydroxyethyl)(methyl)amino)benzaldehyde Chemical Properties |
| Melting point | 66-70 °C(lit.) | | Boiling point | 354.0±27.0 °C(Predicted) | | density | 1.170±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.58±0.10(Predicted) | | color | Brown to Dark Brown | | InChI | InChI=1S/C10H13NO2/c1-11(6-7-12)10-4-2-9(8-13)3-5-10/h2-5,8,12H,6-7H2,1H3 | | InChIKey | JOCUIVLSLBBESN-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(N(CCO)C)C=C1 | | CAS DataBase Reference | 1201-91-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2922500090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-((2-Hydroxyethyl)(methyl)amino)benzaldehyde Usage And Synthesis |
| Uses | N-Methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde may be used to synthesize:
- 2,5-bis[4-(methylaminoethanol)benzylidene]cyclopentanone
- 4′-[(2-tosyloxyethyl)(methyl)amino]-4-phenyl-3-buten-2-malonitrile, a tosylate precursor
- methanesulfonic acid 2-[(4-formyl-phenyl)-methyl-amino]-ethyl ester
| | Uses | 4-[(2-hydroxyethyl)methylamino]-Benzaldehyde is used in the synthesis crosslinkable tricyanopyrroline polymeric electro-optic materials. 4-[(2-hydroxyethyl)methylamino]-Benzaldehyde is also used in th
e chemical process when synthesizing polymethacrylates. |
| | 4-((2-Hydroxyethyl)(methyl)amino)benzaldehyde Preparation Products And Raw materials |
|