Company Name: |
ChemStrong Scientific Co.,Ltd
|
Tel: |
0755-66853366 13670046396 |
Email: |
sales@chem-strong.com |
Products Intro: |
Product Name:Epalrestat Impurity 16 CAS:1151944-57-8 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
(Z)-2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetic acid manufacturers
- Epalrestat Impurity 9
-
- $0.00 / 10mg
-
2024-04-05
- CAS:1151944-57-8
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
|
| (Z)-2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetic acid Basic information |
| (Z)-2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetic acid Chemical Properties |
Melting point | 247-248 °C(Solv: acetic acid (64-19-7)) | Boiling point | 482.0±55.0 °C(Predicted) | density | 1.54±0.1 g/cm3(Predicted) | pka | 3.62±0.10(Predicted) | InChI | InChI=1S/C12H9NO3S2/c14-10(15)7-13-11(16)9(18-12(13)17)6-8-4-2-1-3-5-8/h1-6H,7H2,(H,14,15)/b9-6- | InChIKey | CMANXDDFFAZWJR-TWGQIWQCSA-N | SMILES | S1/C(=C\C2=CC=CC=C2)/C(=O)N(CC(O)=O)C1=S |
| (Z)-2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetic acid Usage And Synthesis |
| (Z)-2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetic acid Preparation Products And Raw materials |
|