|
|
| | TRIS(2,2,2-TRIFLUOROETHYL)PHOSPHATE Basic information |
| Product Name: | TRIS(2,2,2-TRIFLUOROETHYL)PHOSPHATE | | Synonyms: | TRIS(2,2,2-TRIFLUOROETHYL)PHOSPHATE;phosphoric acid tris(2,2,2-trifluoroethyl) ester;Tris(2,2,2-trifluoroethyl)phosphate ,98%;TFEP;NSC 191836;Ethanol,2,2,2-trifluoro-, phosphate (3:1);Tri (2,2,2-trifluoroethyl) phosphate;ris(2,2,2-trifluoroethyl)phosphate | | CAS: | 358-63-4 | | MF: | C6H6F9O4P | | MW: | 344.07 | | EINECS: | | | Product Categories: | | | Mol File: | 358-63-4.mol |  |
| | TRIS(2,2,2-TRIFLUOROETHYL)PHOSPHATE Chemical Properties |
| Melting point | -22℃ | | Boiling point | 186-189℃ | | density | 1.56 | | refractive index | 1.3200 (20℃) | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C6H6F9O4P/c7-4(8,9)1-17-20(16,18-2-5(10,11)12)19-3-6(13,14)15/h1-3H2 | | InChIKey | ZMQDTYVODWKHNT-UHFFFAOYSA-N | | SMILES | P(OCC(F)(F)F)(OCC(F)(F)F)(OCC(F)(F)F)=O |
| Hazard Codes | Xi | | RIDADR | 3272 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29199000 |
| | TRIS(2,2,2-TRIFLUOROETHYL)PHOSPHATE Usage And Synthesis |
| Chemical Properties | Phosphoric acid tris(2,2,2-trifluoroethyl) ester is a kind of organic compound widely used in chemical, pharmaceutical, electronic and other fields, its chemical structure contains Phosphoricacid, trifluoroethanol and other groups, and the characteristics of these groups make the compound has excellent chemical and physical properties. Its properties are colorless and transparent liquid, showing low viscosity and low surface tension at room temperature, easy to flow and mix. The compound is less dense, lighter than water and easily volatilized. Also, tris(2,2,2-trifluoroethyl) phosphate has good dielectric properties and can be used to prepare highly efficient dielectric materials. From the perspective of chemical properties, tris(2,2,2-trifluoroethyl) phosphate is a non-polar organic compound with excellent solubility and permeability. The compound also contains many fluorine atoms in its chemical structure, which gives it high chemical stability and flame retardancy. In addition, tris(2,2,2-trifluoroethyl) phosphate has good thermal stability and excellent antioxidant properties to withstand the effects of time and the environment. | | Uses | Tris(2,2,2-trifluoroethyl)phosphate is a useful chemical used as nonflammable electrolytes for Li-ion batteries. |
| | TRIS(2,2,2-TRIFLUOROETHYL)PHOSPHATE Preparation Products And Raw materials |
|