|
|
| | 6-Phenylhexanoic acid Basic information |
| | 6-Phenylhexanoic acid Chemical Properties |
| Melting point | 17-19°C | | Boiling point | 201-202 °C24 mm Hg(lit.) | | density | 1.022 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.51(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | solubility | Difficult to mix. | | pka | 4.78±0.10(Predicted) | | form | Solid | | color | White | | Water Solubility | 479.8mg/L(30 ºC) | | BRN | 1950106 | | InChI | InChI=1S/C12H16O2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,13,14) | | InChIKey | JTXZPQIXIXYMDY-UHFFFAOYSA-N | | SMILES | C1(CCCCCC(O)=O)=CC=CC=C1 | | CAS DataBase Reference | 5581-75-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29163900 |
| | 6-Phenylhexanoic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 6-Phenylhexanoic Acid (cas# 5581-75-9) is a compound useful in organic synthesis. | | Application | 6-Phenylhexanoic acid was employed as a model compound to investigate the effects of chromophore orientation and molecular conformation on surface-enhanced Raman scattering based on metal nanostructures. It was also employed as a substrate to study the stoichiometry of side chain metabolism or complete mineralization of surrogate napthenic acids under methanogenic conditions. | | General Description | 6-Phenylhexanoic acid is an arylalkanoic acid. |
| | 6-Phenylhexanoic acid Preparation Products And Raw materials |
|