|
|
| | 4,4'-Di-tert-butyl-2,2'-dipyridyl Basic information | | Reaction |
| Product Name: | 4,4'-Di-tert-butyl-2,2'-dipyridyl | | Synonyms: | 4 4'-DI-TERT-BUTYL-2 2'-DIPYRIDYL 98;4,4'-Di-O-tert-butyl-2,2'-bypyridine;4,4'-Di-tert-butyl-2,2'-dipyridyl 98%;4,4'-Di-tert-butyl-2,2'-dipyridine;4,4'-Bis(di-t-butyl)-2,2'-bipyridine;4,4'-Di-tert-butyl-2,2'-bipyridine;4,4'-DI-TERT-BUTYL-2,2'-BYPYRIDINE;4,4'-Bis(t-butyl)-2,2'-bipyridine | | CAS: | 72914-19-3 | | MF: | C18H24N2 | | MW: | 268.4 | | EINECS: | | | Product Categories: | Heterocycle-Pyridine series;Achiral Nitrogen;Py-N;C9 to C46;Heterocyclic Building Blocks;Pyridines | | Mol File: | 72914-19-3.mol |  |
| | 4,4'-Di-tert-butyl-2,2'-dipyridyl Chemical Properties |
| Melting point | 159-161 °C(lit.) | | Boiling point | 395.4±42.0 °C(Predicted) | | density | 0.977 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 5.15±0.30(Predicted) | | form | crystal | | color | white | | Stability: | hygroscopic | | InChI | InChI=1S/C18H24N2/c1-17(2,3)13-7-9-19-15(11-13)16-12-14(8-10-20-16)18(4,5)6/h7-12H,1-6H3 | | InChIKey | TXNLQUKVUJITMX-UHFFFAOYSA-N | | SMILES | C1(C2=NC=CC(C(C)(C)C)=C2)=NC=CC(C(C)(C)C)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29333990 |
| | 4,4'-Di-tert-butyl-2,2'-dipyridyl Usage And Synthesis |
| Reaction |
- Ligand for the iridium-catalyzed borylation of arenes
- Ligand for the iridium-catalyzed synthesis of arylboronic acids and aryl trifluoroborates
- Ligand for the nickel-catalyzed hydroxycarboxylation of 1,2-dienes by reaction carbon dioxide and oxygen
- Ligand for the iridium-catalyzed meta borylation followed by halogenation of 1,3-disubstituted arenes
- Ligand for the iridium-catalyzed silyl-directed ortho-borylation of arenes
- Ligand for the iridium-catalyzed silane borylation followed by aryl borylation
- Ligand for the iridium-catalyzed microwave-accelerated borylation of aromatic C-H bonds
- Ligand for the iridium-catalyzed silyl-directed borylation of indoles
- Ligand for the nickel-catalyzed synthesis of functionalized dialkyl ketones from carboxylic acids and alkyl halides
- Ligand for the iron-catalyzed arylation of heterocycles
| | Chemical Properties | white cyrstalline powder | | Uses | 4,4''-Di-tert-butyl-2,2''-bipyridine acts as a reagent in the preparation, antiproliferative and cytotoxic activity of apoptotic ruthenium nitrogen heterocyclic complexes via combinatorial library synthesis. |
| | 4,4'-Di-tert-butyl-2,2'-dipyridyl Preparation Products And Raw materials |
|