|
|
| | N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide Basic information |
| Product Name: | N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide | | Synonyms: | N-(2-Amino-4.6-dichloro-5-pyrimdinyl) formamide;2,5-Diamino-4,6-DichloroformamidoHcl;N-(2-Amino-4,6-Dichloro-5-Pyri;N-(2-AMINO-4,6-DICHLOROPYRIMIDIN-5-YL) FORMAMIDE[FOR ABACAVIR];N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide;2-Amino-4,6-dichloro-5-formamidopyrimidine;N-(2-aMino-4,6-dichloro-1,2-dihydropyriMidin-5-yl)
forMaMide;N-(2-aMino-4,6-dichloro-1,2-dihydropyriMidin-5-yl) | | CAS: | 171887-03-9 | | MF: | C5H4Cl2N4O | | MW: | 207.02 | | EINECS: | 425-650-6 | | Product Categories: | Heterocycle-Pyrimidine series;Bases & Related Reagents;Heterocycle;Heterocyclic Compounds;Heterocycles;Nucleotides;3 | | Mol File: | 171887-03-9.mol |  |
| | N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide Chemical Properties |
| Melting point | >251°C (dec.) | | Boiling point | 554.8±60.0 °C(Predicted) | | density | 1.742±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO, Methanol | | form | Solid | | pka | 10.90±0.70(Predicted) | | color | Off-White to Pale Beige | | InChI | InChI=1S/C5H4Cl2N4O/c6-3-2(9-1-12)4(7)11-5(8)10-3/h1H,(H,9,12)(H2,8,10,11) | | InChIKey | XYWHZUCZNRMJGO-UHFFFAOYSA-N | | SMILES | C(NC1=C(Cl)N=C(N)N=C1Cl)=O | | CAS DataBase Reference | 171887-03-9(CAS DataBase Reference) |
| | N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Abacavir intermediate. A purine derivative | | Uses | N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide (Abacavir - In House Impurity) is an intermediate of Abacavir (A105000). Abacavir is a carbocyclic 2''-deoxyguanosine nucleoside reverse transcriptase inhibitor and an anti-HIV drug used to treat HIV infection (1). Intracellular enzymes convert Abacavir to its active form, carbovir-triphosphate (CBV-TP), which then selectively inhibits HIV reverse transcriptase by incorporating into viral DNA (2). Abacavir is metabolized in the liver by uridine diphosphate glucuronyltransferase and alcohol dehydrogenase resulting in inactive glucuronide and carboxylate metabolites, respectively. | | Uses | Prasugrel intermediate | | Synthesis | 1. 2,5-diamino-4,6-dichloropyrimidine (0.01 mol, 2.0 g) was mixed with water (0.25 mol, 4.55 mL) at room temperature and stirred.
2. 98% formic acid (0.4 mol, 18.27 g, 14.97 mL) was slowly added to the reaction system.
3. The reaction mixture was heated to 50-55 °C and maintained at this temperature for 3 hours.
4. Upon completion of the reaction, toluene (0.38 mol, 34.6 g, 40 mL) was added to the reaction system at 50 °C for azeotropic distillation. This process was repeated once, using a total of 80 mL of toluene to ensure adequate distillation.
5. After the reaction mixture was cooled, the solid product was collected by filtration and washed with cold water.
6. The washed product was dried under vacuum at 60°C. 7.
7. 2-amino-4,6-dichloro-5-formamidopyrimidine (0.01 mol, 2.0 g) was finally obtained in about 90% yield. | | References | [1] Patent: EP1188750, 2002, A1. Location in patent: Page 5 |
| | N-(2-Amino-4,6-dichloro-5-pyrimidinyl)formamide Preparation Products And Raw materials |
|