| Company Name: |
Zhengzhou Deyuankai Chemical Co., LTD Gold
|
| Tel: |
17837139533 |
| Email: |
1165412154@qq.com |
| Products Intro: |
Product Name:(Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile
CAS:1402049-87-9
Purity:98% Package:1g；5g；25g；100g；500g
|
| Company Name: |
Shanghai Na Qian Chemical Technology Co. Ltd.
|
| Tel: |
0373-7129549; 13598610367 |
| Email: |
2841375912@qq.com |
| Products Intro: |
Product Name:(Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile
CAS:1402049-87-9
Purity:98% Package:100g
|
| Company Name: |
Zhengzhou Alfachem Co., Ltd.
|
| Tel: |
0371-53765687 18937137882 |
| Email: |
2853979813@qq.com |
| Products Intro: |
Product Name:(Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile
CAS:1402049-87-9
Purity:98% Package:50g；100g；500g；1kg；5kg；25kg
|
| Company Name: |
Zhengzhou JACS Chemical Co., Ltd.
|
| Tel: |
0371-0371-86259281 15981966935 |
| Email: |
jacschem@163.com |
| Products Intro: |
Product Name:1402049-87-9
CAS:1402049-87-9
Purity:98% Package:1g 5g 10g 25g 50g 100g 500g 1kg
|
| Company Name: |
Zhengzhou Acme Chemical Co., Ltd.
|
| Tel: |
0371-63315541 13323832564 |
| Email: |
3001332135@qq.com |
| Products Intro: |
Product Name:(Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile
CAS:1402049-87-9
Purity:97% Package:1g;5g;25g;50g
|
|
| | (Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile Basic information |
| | (Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile Chemical Properties |
| Melting point | 163-164 °C | | Boiling point | 582.5±50.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | pka | -3.60±0.60(Predicted) | | InChI | InChI=1S/C27H19BrN2/c28-24-15-13-22(14-16-24)23(20-29)19-21-11-17-27(18-12-21)30(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-19H | | InChIKey | VCXBXUOELYSTRE-UHFFFAOYSA-N | | SMILES | N(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC(C=C(C2C=CC(Br)=CC=2)C#N)=CC=1 |
| | (Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile Usage And Synthesis |
| | (Z) -2- (4-bromophenyl) -3- (4- (di-p-toluidine) phenyl) acetonitrile Preparation Products And Raw materials |
|