|
| 3,3'-Difluorobenzophenone Basic information |
| 3,3'-Difluorobenzophenone Chemical Properties |
Melting point | 59-61 °C (lit.) | Boiling point | 316℃ | density | 1.239 | Fp | 121℃ | form | powder | color | White | BRN | 1959286 | InChI | InChI=1S/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H | InChIKey | UBJLBNGSWJBOGI-UHFFFAOYSA-N | SMILES | C(C1=CC=CC(F)=C1)(C1=CC=CC(F)=C1)=O | CAS DataBase Reference | 345-70-0(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-37/39 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 2914390090 |
| 3,3'-Difluorobenzophenone Usage And Synthesis |
Uses | 3,3′-Difluorobenzophenone may be used in chemical synthesis. |
| 3,3'-Difluorobenzophenone Preparation Products And Raw materials |
|