- Ecliptasaponin A
-
- $59.00 / 1mL
-
2026-04-21
- CAS:78285-90-2
- Min. Order:
- Purity: 99.65%
- Supply Ability: 10g
|
| | ECHINOCYSTIC ACID-3-GLUCOSIDE Basic information |
| Product Name: | ECHINOCYSTIC ACID-3-GLUCOSIDE | | Synonyms: | ECHINOCYSTIC ACID-3-GLUCOSIDE;ECHINOCYSTIC ACID-3-O-GLUCOSIDE;(3beta,16alpha)-3-(beta-D-glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid;(3β,16α)-3-(β-D-Glucopyranosyloxy)-16-hydroxyolean-12-en-28-oic acid;ECHINOCYSTIC ACID-3-O-GLUCOSIDE WITH HPLC;3β-(β-D-Glucopyranosyloxy)-16α-hydroxyolean-12-en-28-oic acid;Gleditschoside B;Gleditsoside B | | CAS: | 78285-90-2 | | MF: | C36H58O9 | | MW: | 634.84 | | EINECS: | 278-887-0 | | Product Categories: | | | Mol File: | 78285-90-2.mol |  |
| | ECHINOCYSTIC ACID-3-GLUCOSIDE Chemical Properties |
| Melting point | 237~238℃ | | Boiling point | 752.6±60.0 °C(Predicted) | | density | 1.27±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | Soluble in methan | | pka | 4.42±0.70(Predicted) | | form | Solid | | color | White | | BRN | 1613820 | | InChIKey | WYDPEADEZMZKNM-ZBKPBKBGSA-N | | SMILES | CC1(C)CC[C@@]2([C@H](O)C[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O | | LogP | 5.610 (est) |
| WGK Germany | 3 | | HS Code | 29389090 | | Storage Class | 13 - Non Combustible Solids |
| | ECHINOCYSTIC ACID-3-GLUCOSIDE Usage And Synthesis |
| Chemical Properties | White crystalline powder, easily soluble in methanol, derived from Eclipta chinensis. | | Uses | Ecliptasaponin A has anti-tumor and immunological properties, it can be used for determination/identification/pharmacological experiments, etc. | | Definition | ChEBI: Echinocystic acid 3-glucoside is a triterpenoid saponin. | | Biological Activity | Ecliptasaponin A, a pentacyclic triterpenoid saponin, is one of the main compounds isolated from Eclipta prostrate. Eclipta is considered a tonic herb with pleiotropic effects, including anti-inflammatory, hepatoprotective, antioxidant and immunomodulatory. | | target | TGF-β/Smad | COX | MMP(e.g.TIMP) | α-SMA | SOD |
| | ECHINOCYSTIC ACID-3-GLUCOSIDE Preparation Products And Raw materials |
|