|
|
| | 2-HYDROXY-3-METHYLBUTYRIC ACID Basic information |
| Product Name: | 2-HYDROXY-3-METHYLBUTYRIC ACID | | Synonyms: | (+/-)-2-HYDROXY-3-METHYLBUTYRIC ACID;2-HYDROXY-3-METHYLBUTYRIC ACID;A-HYDROXYISOVALERIC ACID;AKOS 239-06;(+/-)-ALPHA-HYDROXYISOVALERIC ACID;ALPHA-HYDROXYISOVALERIC ACID;(+/-)-2-HYDROXY-3-METHYLBUTYRIC ACID, 99 %;(2S)-2-hydroxy-3-methyl-butanoic acid | | CAS: | 4026-18-0 | | MF: | C5H10O3 | | MW: | 118.13 | | EINECS: | 223-697-5 | | Product Categories: | | | Mol File: | 4026-18-0.mol |  |
| | 2-HYDROXY-3-METHYLBUTYRIC ACID Chemical Properties |
| Melting point | 86-87 °C (lit.) | | Boiling point | 120-125 °C(Press: 17 Torr) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in dimethyl sulfoxide and methanol. | | pka | 3.87±0.16(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8) | | InChIKey | NGEWQZIDQIYUNV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(O)C(C)C | | LogP | 0.013 (est) | | CAS DataBase Reference | 4026-18-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-HYDROXY-3-METHYLBUTYRIC ACID Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2-Hydroxy-3-methylbutyric Acid is a α-hydroxylated butyric acid derivative used as a marker in chemical diagnosis of organic aciduria and other inborn errors. 2-Hydroxy-3-methylbutyric Acid is also us
ed as a metabolomic biomarkers in preeclampsia. | | Uses | 2-Hydroxy-3-methylbutyric acid is employed as internal standard for analysis of ethylene glycol (EG) and γ-hydroxybutyrate (GHB) in whole blood. | | Definition | ChEBI: A valine derivative that is valine in which the amino group has been replaced by a hydroxy group. | | General Description | Chiral resolution of 2-hydroxy-3-methylbutyric acid without derivatization has been studied by capillary electrophoresis using 2-hydroxypropyl-β-cyclodextrin. | | IC 50 | Human Endogenous Metabolite |
| | 2-HYDROXY-3-METHYLBUTYRIC ACID Preparation Products And Raw materials |
|