- 3,5-Dinitro-o-toluic acid
-
- $27.91 / 25Kg/Drum
-
2026-04-20
- CAS:28169-46-2
- Min. Order: 25Kg/Drum
- Purity: 99.00%HPLC
- Supply Ability: 10tons/month
|
| | 3,5-Dinitro-2-methylbenzoic acid Basic information |
| Product Name: | 3,5-Dinitro-2-methylbenzoic acid | | Synonyms: | 3,5-Dinitro-o-Toluic Acid 2-Methyl-3,5-Dinitrobenzoic acid;2-methyl-3,5-dinitro-benzoicaci;AKOS BB-9478;3,5-DINITRO-2-METHYLBENZOIC ACID;3,5-DINITRO-2-TOLUIC ACID;3,5-DINITRO-O-TOLUIC ACID;2-METHYL-3,5-DINITROBENZOIC ACID;3,5-DINITRO-O-TOLUIC ACID 99% | | CAS: | 28169-46-2 | | MF: | C8H6N2O6 | | MW: | 226.14 | | EINECS: | 248-880-7 | | Product Categories: | FINE Chemical & INTERMEDIATES;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Organic acids;C8;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 28169-46-2.mol |  |
| | 3,5-Dinitro-2-methylbenzoic acid Chemical Properties |
| Melting point | 205-207 °C(lit.) | | Boiling point | 367.74°C (rough estimate) | | density | 1.6136 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | pK1:2.97 (25°C) | | Appearance | White to off-white Solid | | Water Solubility | Soluble in water. | | BRN | 2622906 | | Henry's Law Constant | 3.7×106 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) | | InChI | InChI=1S/C8H6N2O6/c1-4-6(8(11)12)2-5(9(13)14)3-7(4)10(15)16/h2-3H,1H3,(H,11,12) | | InChIKey | CDVNZMKTJIBBBV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1C | | CAS DataBase Reference | 28169-46-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-methyl-3,5-dinitro- (28169-46-2) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,5-Dinitro-2-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | light yellow fine crystalline powder | | Uses | 2-Methyl-3,5-dinitrobenzoic acid was used to synthesis heterocyclic derivatives and in the synthesis of isoquinolone. | | General Description | Synthesis of a series of heterocyclic derivatives of 3,5-dinitro-o-toluic acid has been reported. | | Purification Methods | Crystallise the acid from H2O or aqueous EtOH. The ammonium salt forms yellow crystals from EtOH with m 218-219o, and the urea salt has m 189-190o (prisms from EtOH). [Beilstein 9 H 474, 9 II 323, 9 III 2316.] |
| | 3,5-Dinitro-2-methylbenzoic acid Preparation Products And Raw materials |
|