|
|
| | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride Basic information |
| | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride Chemical Properties |
| Melting point | 191-193°C | | density | 1.154 g/mL at 25 °C | | vapor pressure | 0.001Pa at 20℃ | | refractive index | n20/D 1.4541 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol (Slightly), Water (Sparingly) | | form | clear liquid | | color | Colorless to Light yellow | | PH | 4.8 to 6.4(50g/L, 25℃) | | Water Solubility | 835.2g/L at 20℃ | | BRN | 6576172 | | InChI | InChI=1S/C6H15ClNO.ClH/c1-8(2,3)5-6(9)4-7;/h6,9H,4-5H2,1-3H3;1H/q+1;/p-1 | | InChIKey | CSPHGSFZFWKVDL-UHFFFAOYSA-M | | SMILES | [N+](C)(CC(O)CCl)(C)C.[Cl-] | | LogP | -1.5 at 25℃ | | CAS DataBase Reference | 3327-22-8(CAS DataBase Reference) | | EPA Substance Registry System | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride (3327-22-8) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-52/53-40 | | Safety Statements | 26-36-61-36/37 | | RIDADR | 2811 | | WGK Germany | 2 | | RTECS | BP5275400 | | HS Code | 2923.90.0100 | | HazardClass | 6.1(b) | | PackingGroup | III | | Toxicity | LDLo subcutaneous in mouse: 500mg/kg |
| | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride Usage And Synthesis |
| Uses | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride is used in the preparation of multifunctional cationized cotton fabric based on TiO2 nanomaterials. | | Uses | (3-Chloro-2-hydroxypropyl)trimethylammonium chloride solution (CHTAC) can be used:
- As a cation-generating agent for cellulose cationization by exhaustion method.
- To resolve 2,2′-dihydroxy-1,1′-binaphthyl enantiomers.
- To synthesize cationic glycogen (Cat Gly).
- As a quaternizing agent for quaternization of N-aryl chitosan derivatives.
| | Flammability and Explosibility | Non flammable |
| | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride Preparation Products And Raw materials |
|