6-AMINO-2-METHYL-2H-INDAZOLE manufacturers
|
| 6-AMINO-2-METHYL-2H-INDAZOLE Basic information | Appearance |
| 6-AMINO-2-METHYL-2H-INDAZOLE Chemical Properties |
Melting point | 148-150 | Boiling point | 354.8±15.0 °C(Predicted) | density | 1.27±0.1 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | pka | 3.31±0.10(Predicted) | form | Crystalline Powder | color | Yellow to green | InChI | InChI=1S/C8H9N3/c1-11-5-6-2-3-7(9)4-8(6)10-11/h2-5H,9H2,1H3 | InChIKey | MHCWLERQNFATHZ-UHFFFAOYSA-N | SMILES | N1=C2C(C=CC(N)=C2)=CN1C |
Hazard Codes | Xi | HazardClass | IRRITANT | HS Code | 29339980 |
| 6-AMINO-2-METHYL-2H-INDAZOLE Usage And Synthesis |
Appearance |
Brown crystalline powder
| Uses | 2-Methyl-2H-indazol-6-ylamine is a research chemical that can be used as a pharmaceutical intermediate. |
| 6-AMINO-2-METHYL-2H-INDAZOLE Preparation Products And Raw materials |
|