3-Hydroxy-1,8-naphthalic anhydride manufacturers
|
| | 3-Hydroxy-1,8-naphthalic anhydride Basic information |
| Product Name: | 3-Hydroxy-1,8-naphthalic anhydride | | Synonyms: | 3-Hydroxy-1,8-naphthalenedicarboxylic anhydride;hydroxynaphthalicanhydride;3-HYDROXY-1,8-NAPHTHALIC ANHYDRIDE;5-HYDROXY-BENZO[DE]ISOCHROMENE-1,3-DIONE;3-Hydroxy-1,8-naphthalenedicarboxylic acid=anhydride ester;3-Hydroxynaphthalene-1,8-dicarboxylic anhydride;Albb-005281;3-Hydroxynaphthalic anhydride | | CAS: | 23204-36-6 | | MF: | C12H6O4 | | MW: | 214.17 | | EINECS: | | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 23204-36-6.mol |  |
| | 3-Hydroxy-1,8-naphthalic anhydride Chemical Properties |
| Melting point | 281 °C | | Boiling point | 509.4±33.0 °C(Predicted) | | density | 1.585±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Dimethylformamide | | form | powder to crystal | | pka | 7.93±0.20(Predicted) | | color | Light yellow to Yellow | | InChI | InChI=1S/C12H6O4/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5,13H | | InChIKey | FKVNZFAMXGMPOU-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C2=CC(O)=CC3=C2C1=CC=C3 |
| | 3-Hydroxy-1,8-naphthalic anhydride Usage And Synthesis |
| Uses | Used as pharmaceutical intermediates for RD. | | Synthesis | General procedure for the synthesis of 5-hydroxybenzo[de]isochroman-1,3-dione from 5-amino-1H,3H-benzo[DE]isochroman-1,3-dione: Compound 3 (8 mmol, 1.7 g) was placed in a three-necked flask, and 432 mL of aqueous sulfuric acid solution (sulfuric acid to water in a ratio of 1:5, by volume) was added and the reaction system was cooled down to 0 °C. Subsequently, sodium nitrite (12 mmol, 0.81 g) was slowly added and stirred continuously at 0 °C for 1 hour. After completion of the reaction, the reaction system was gradually warmed to room temperature and then stirred at 120 °C for 12 hours. At the end of the reaction, the reaction mixture was cooled to room temperature, filtered through a Kiriyama funnel and the filter cake was washed with water and dried. The crude product was recrystallized with chloroform to afford the target product 5-hydroxybenzo[de]isochromene-1,3-dione. | | References | [1] Patent: JP2018/39777, 2018, A. Location in patent: Paragraph 0115; 0119; 0120 [2] Journal of Photochemistry and Photobiology A: Chemistry, 2015, vol. 303-304, p. 28 - 35 |
| | 3-Hydroxy-1,8-naphthalic anhydride Preparation Products And Raw materials |
|