| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
OTAVA chemicals |
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
|
| | AURORA 21587 Basic information |
| Product Name: | AURORA 21587 | | Synonyms: | OTAVA-BB BB7016390881;AURORA 21587;AKOS BBS-00009316;OTAVA-BB 7016390881;UKRORGSYN-BB BBV-077725;Acetamide, N,N-diethyl-2-(4-formylphenoxy)-;N,N-Diethyl-2-(4-formylphenoxy)acetamide | | CAS: | 685853-68-3 | | MF: | C13H17NO3 | | MW: | 235.28 | | EINECS: | | | Product Categories: | | | Mol File: | 685853-68-3.mol |  |
| | AURORA 21587 Chemical Properties |
| Boiling point | 403.5±25.0 °C(Predicted) | | density | 1.109±0.06 g/cm3(Predicted) | | pka | -0.90±0.70(Predicted) | | form | solid | | InChI | 1S/C13H17NO3/c1-3-14(4-2)13(16)10-17-12-7-5-11(9-15)6-8-12/h5-9H,3-4,10H2,1-2H3 | | InChIKey | HVIDYQCYIDTDFR-UHFFFAOYSA-N | | SMILES | O=C(COC(C=C1)=CC=C1C=O)N(CC)CC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | AURORA 21587 Usage And Synthesis |
| | AURORA 21587 Preparation Products And Raw materials |
|