- Isopropyl Nitrite
-
- $0.00 / 10kg
-
2024-06-11
- CAS:541-42-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100 tons
- Isopropyl Nitrite
-
- $0.00 / 10kg
-
2024-06-11
- CAS:541-42-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100 tons
- Isopropyl Nitrite
-
- $0.00 / 10kg
-
2024-06-11
- CAS:541-42-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100 tons
|
| | ISOPROPYL NITRITE Basic information |
| Product Name: | ISOPROPYL NITRITE | | Synonyms: | 1-methylethylnitrite;2-propanolnitrite;isopropylesterkyselinydusite;nitrousacid,1-methylethylester;nitrousacid,isopropylester;nitrousacidisopropylester;2-(Nitrosooxy)propane;propan-2-yl nitrite | | CAS: | 541-42-4 | | MF: | C3H7NO2 | | MW: | 89.09 | | EINECS: | 208-779-0 | | Product Categories: | | | Mol File: | 541-42-4.mol |  |
| | ISOPROPYL NITRITE Chemical Properties |
| Boiling point | 39℃ | | density | 1.02 | | vapor pressure | 57.595-61.088kPa at 25℃ | | refractive index | nD20 1.3520 | | Fp | -37℃ | | InChI | InChI=1S/C3H7NO2/c1-3(2)6-4-5/h3H,1-2H3 | | InChIKey | SKRDXYBATCVEMS-UHFFFAOYSA-N | | SMILES | N(=O)OC(C)C | | LogP | 1.79 | | EPA Substance Registry System | Nitrous acid, 1-methylethyl ester (541-42-4) |
| | ISOPROPYL NITRITE Usage And Synthesis |
| Uses | Isopropyl nitrite is used in the preparation of heterocyclic amides as RIP1 kinase inhibitors. | | Uses | Jet propellant. |
| | ISOPROPYL NITRITE Preparation Products And Raw materials |
|