|
|
| | 1,2,3-Triacetyl-5-deoxy-D-ribose Basic information |
| Product Name: | 1,2,3-Triacetyl-5-deoxy-D-ribose | | Synonyms: | 1,2,3-Triacetyl-5-deoxy-D-ribose;1,2,3-Triacetoxy-5-Deoxy Ribose;1,2,3-Triacetoxy-5-Deoxy-Beta-D-Ribofuranose;1,2,6-TRI-O-ACETYL-3,4-DI-O-BENZYL-ALPHA-D-MANNOPYRANOSE;5-Deoxy-b-D-ribofuranose;ACETYLFURANOSIDE;b-D-Ribofuranose, 5-deoxy-,1,2,3-triacetate;5-Deoxy-b-D-ribofuranose triacetate | | CAS: | 62211-93-2 | | MF: | C11H16O7 | | MW: | 260.24 | | EINECS: | 612-957-7 | | Product Categories: | Carbohydrates & Derivatives;Intermediates;Antineoplastic drug, 5-FU analog;Capecitabine intermediate;bc0001;62211-93-2 | | Mol File: | 62211-93-2.mol |  |
| | 1,2,3-Triacetyl-5-deoxy-D-ribose Chemical Properties |
| Melting point | 63-64°C | | Boiling point | 315°C | | alpha | -19.0 to -23.0 deg(C=2, EtOH) | | density | 1.23 | | vapor pressure | 0.005-0.01Pa at 20-25℃ | | Fp | 136°C | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in ethanol | | form | Powder | | color | Yellow to Brown | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C11H16O7/c1-5-9(16-6(2)12)10(17-7(3)13)11(15-5)18-8(4)14/h5,9-11H,1-4H3/t5-,9-,10-,11+/s3 | | InChIKey | NXEJETQVUQAKTO-QPGVQJSANA-N | | SMILES | O([C@H]1[C@@H](O[C@H](C)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,4,6,r| | | LogP | 0.377-0.43 at 25℃ | | Surface tension | 39.28mN/m at 1.01g/L and 20℃ | | CAS DataBase Reference | 62211-93-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29400090 |
| | 1,2,3-Triacetyl-5-deoxy-D-ribose Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Intermediate in the preparation of Cepecitabine. | | Synthesis | Preparation of triacetyl ribose α isomers. The specific method uses 5-deoxy-D-ribose as starting material, which is acetylated in the presence of acrylate acetate/ferric chloride to obtain a mixture of triacetyl ribose isomers, which is further purified to the triacetyl ribose α isomer pure product. The reaction raw material 5-deoxy-D-ribose is a known compound, and samples thereof can be obtained by the synthetic method of Patent WO2008/105593, in which samples were prepared by heating and hydrolyzing with sulfuric acid from methyl-5-deoxy-2,3-O-isopropylidene-β-D-riboside (V).
|
| | 1,2,3-Triacetyl-5-deoxy-D-ribose Preparation Products And Raw materials |
|