|
|
| | N,N'-Bis(methylphenyl)-1,4-benzenediamine Basic information |
| Product Name: | N,N'-Bis(methylphenyl)-1,4-benzenediamine | | Synonyms: | N,N'-Ditolyl-p-phenylenediamine;N,N'-Ditolyl-1,4-phenylenediamine;N1,N4-Bis(methylphenyl)-1,4-benzenediamine;Antioxidant DTPD;N,N'-Bis (Methylphenyl)-1,4-Benzenediamine;N,N'-Bis(methylphenyl)-1,4-benzenediamine;N,N'-ditolyl-para-phenylene diamine;N,N'-Bis(methylphenyl)-1,4-benzenediamine ISO 9001：2015 REACH | | CAS: | 27417-40-9 | | MF: | C20H20N2 | | MW: | 288.39 | | EINECS: | | | Product Categories: | Industrial/Fine Chemicals | | Mol File: | 27417-40-9.mol |  |
| | N,N'-Bis(methylphenyl)-1,4-benzenediamine Chemical Properties |
| Melting point | 183.5-185.5 °C | | storage temp. | Refrigerator | | solubility | Acetone (Slightly), Benzene (Very Slightly), Chloroform (Slightly), DMSO (Very Slightly) | | form | Solid | | color | Dark Brown | | InChI | InChI=1S/C20H20N2/c1-15-7-3-5-9-19(15)21-17-11-13-18(14-12-17)22-20-10-6-4-8-16(20)2/h3-14,21-22H,1-2H3 | | InChIKey | MDZBMZIJIUEQJS-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1C)NC1=CC=C(NC2C=CC=CC=2C)C=C1 | | LogP | 5.573 (est) | | EPA Substance Registry System | 1,4-Benzenediamine, N,N'-bis(methylphenyl)- (27417-40-9) |
| | N,N'-Bis(methylphenyl)-1,4-benzenediamine Usage And Synthesis |
| Chemical Properties | This product is a mixture of industrial products as blue-brown flakes or brown powder. Insoluble in water, soluble in benzene, toluene, chlorobenzene, acetone and chloroform, slightly soluble in ethanol, insoluble in petroleum ether and dilute hydrochloric acid. | | Uses | N,N''''-Bis(methylphenyl)-1,4-benzenediamine is used in preparation of novel high-strength rubber sound insulation pad composite material. |
| | N,N'-Bis(methylphenyl)-1,4-benzenediamine Preparation Products And Raw materials |
|