- 2,2-Dinaphthylamine
-
- $0.00 / 1Kg
-
2023-11-01
- CAS:532-18-3
- Min. Order: 1Kg
- Purity: 99.9%
- Supply Ability: 30000 Kg
- 2,2-Dinaphthylamine
-
- $35.00/ kg
-
2023-09-18
- CAS:532-18-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 Ton
|
| | 2,2-Dinaphthylamine Basic information | | Uses |
| Product Name: | 2,2-Dinaphthylamine | | Synonyms: | di-2-naphthylamine;N,N-Di(2-naphthyl)amine;N,N-Di(naphth2-yl)-amine;2,2-Dinaphthylamine;N-Naphthalen-2-ylnaphthalen-2-amine;N,N-Di(naphthol-yl amine;2,2'-Iminodinaphthalene;2,2'-Iminobisnaphthalene | | CAS: | 532-18-3 | | MF: | C20H15N | | MW: | 269.34 | | EINECS: | 208-529-0 | | Product Categories: | Amines | | Mol File: | 532-18-3.mol |  |
| | 2,2-Dinaphthylamine Chemical Properties |
| Melting point | 174 °C | | Boiling point | 471 °C | | density | 0.9788 (rough estimate) | | refractive index | 1.7800 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | very slightly in Ethanol | | form | powder to crystal | | color | White to Orange to Green | | Merck | 14,3267 | | InChI | InChI=1S/C20H15N/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14,21H | | InChIKey | SBMXAWJSNIAHFR-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1NC1=CC=C2C(=C1)C=CC=C2 | | NIST Chemistry Reference | 2-Naphthalenamine, N-2-naphthalenyl-(532-18-3) |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2921.49.5000 |
| | 2,2-Dinaphthylamine Usage And Synthesis |
| Uses | DI-NAPHTHALEN-2-YL-AMINE is a useful research chemical. | | Uses | Detection of nitrites, nitrates, and chlorates: Sa, An. Farm. Bioquim. 5, 111 (1934), C.A. 30, 6672 (1936). | | Synthesis Reference(s) | The Journal of Organic Chemistry, 24, p. 1775, 1959 DOI: 10.1021/jo01093a042 |
| | 2,2-Dinaphthylamine Preparation Products And Raw materials |
|