tetrahydro-4-methyl-2H-pyran-2-one manufacturers
|
| tetrahydro-4-methyl-2H-pyran-2-one Basic information |
Product Name: | tetrahydro-4-methyl-2H-pyran-2-one | Synonyms: | tetrahydro-4-methyl-2H-pyran-2-one;3-Methyl-5-valerolactone;4-Methyltetrahydro-2H-pyran-2-one;3-Methyl-5-hydroxypentanoic acid lactone;3-Methyl-5-pentanolide;4-Methyltetrahydro-2-pyrone;β-Methyl-δ-valerolacto;4-methyloxan-2-one | CAS: | 1121-84-2 | MF: | C6H10O2 | MW: | 114.14 | EINECS: | 214-338-3 | Product Categories: | | Mol File: | 1121-84-2.mol |  |
| tetrahydro-4-methyl-2H-pyran-2-one Chemical Properties |
Boiling point | 90 °C(Press: 12 Torr) | density | 1.044 g/cm3(Temp: 25 °C) | InChI | InChI=1S/C6H10O2/c1-5-2-3-8-6(7)4-5/h5H,2-4H2,1H3 | InChIKey | YHTLGFCVBKENTE-UHFFFAOYSA-N | SMILES | C1(=O)OCCC(C)C1 |
| tetrahydro-4-methyl-2H-pyran-2-one Usage And Synthesis |
Synthesis Reference(s) | Journal of the American Chemical Society, 116, p. 5473, 1994 DOI: 10.1021/ja00091a063 Organic Syntheses, Coll. Vol. 4, p. 677, 1963 |
| tetrahydro-4-methyl-2H-pyran-2-one Preparation Products And Raw materials |
|