|
|
| | 2,4-Dichloro-3-nitropyridine Basic information |
| | 2,4-Dichloro-3-nitropyridine Chemical Properties |
| Melting point | 61.5-62 °C | | Boiling point | 285.7±35.0 °C(Predicted) | | density | 1.629±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystal | | pka | -2.49±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C5H2Cl2N2O2/c6-3-1-2-8-5(7)4(3)9(10)11/h1-2H | | InChIKey | RTXYIHGMYDJHEU-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(Cl)=C1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2,4-Dichloro-3-nitropyridine Usage And Synthesis |
| Description | 2,4-Dichloro-3-nitropyridine is a halogenated pyridinium salt that has been shown to inhibit the influenza virus in vitro. This compound is also reactive with nucleophilic groups such as amines, alcohols, and thiols. 2,4-Dichloro-3-nitropyridine has been used for the synthesis of quinoline derivatives that have potential applications in autoimmune diseases or cancer. 2,4-Dichloro-3-nitropyridine has also been found to be an inhibitor of tumor necrosis factor alpha (TNFα) production by LPS stimulated human monocytes. | | Chemical Properties | Light yellow needles | | Uses | 2,4-Dichloro-3-nitropyridine is a reactant in the discovery of Imigliptin, a novel selective dipeptidyl peptidase IV (DPP-4) inhibitor used in the treatment of type 2 diabetes. |
| | 2,4-Dichloro-3-nitropyridine Preparation Products And Raw materials |
|