| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Mephetyl tetrazole
CAS:916923-10-9
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:Mephetyl tetrazole
CAS:916923-10-9
|
|
| | MEPHETYL TETRAZOLE Basic information |
| Product Name: | MEPHETYL TETRAZOLE | | Synonyms: | MEPHETYL TETRAZOLE;1-[2-(4-Methoxyphenyl)ethyl]-5-(1-p-tolylcyclopropyl)-1H-tetrazole;1H-Tetrazole, 1-[2-(4-methoxyphenyl)ethyl]-5-[1-(4-methylphenyl)cyclopropyl]- | | CAS: | 916923-10-9 | | MF: | C20H22N4O | | MW: | 334.41 | | EINECS: | | | Product Categories: | | | Mol File: | 916923-10-9.mol |  |
| | MEPHETYL TETRAZOLE Chemical Properties |
| Boiling point | 558.4±39.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >5mg/mL | | pka | 1.11±0.10(Predicted) | | form | oil | | color | pale yellow | | InChI | 1S/C20H22N4O/c1-15-3-7-17(8-4-15)20(12-13-20)19-21-22-23-24(19)14-11-16-5-9-18(25-2)10-6-16/h3-10H,11-14H2,1-2H3 | | InChIKey | VREPWWBWXVLSEF-UHFFFAOYSA-N | | SMILES | COc1ccc(CCn2nnnc2C3(CC3)c4ccc(C)cc4)cc1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | MEPHETYL TETRAZOLE Usage And Synthesis |
| Uses | Mephetyl tetrazole is a potassium channel Kv1.5 blocker, with an IC50 of 330 nM. Mephetyl tetrazole can be used for the research of cancer[1]. | | Biological Activity | Mephetyl tetrazole is a potent and selective Kv1.5 potassium channel blocker. IC50 = 330 nM; shows selective atrial prolongation (40%) of effective refractory period (ERP), but no effect on ventricular ERP Kv1.5 channel is a molecular target for the treatment of atrial fibrillation. | | References | [1] Felipe A, et al. Targeting the voltage-dependent K(+) channels Kv1.3 and Kv1.5 as tumor biomarkers for cancer detection and prevention. Curr Med Chem. 2012;19(5):661-74. DOI:10.2174/092986712798992048 |
| | MEPHETYL TETRAZOLE Preparation Products And Raw materials |
|