| Company Name: |
Zhengzhou Gecko Scientific Inc. Gold
|
| Tel: |
0371-63336364 17344886665 |
| Email: |
209932355@qq.com |
| Products Intro: |
Product Name:Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl-
CAS:16259-59-9
Purity:95LC Package:5g
|
| Company Name: |
Henan qinpeng technology co., ltd
|
| Tel: |
18839185240 |
| Email: |
2148319152@qq.com |
| Products Intro: |
Product Name:Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl-
CAS:16259-59-9
Purity:95 Package:1g,kg;10g,kg;100g,kg
|
| Company Name: |
Henan Research New Material Co., Ltd.
|
| Tel: |
1890-3931531 18903931628 |
| Email: |
sales036@researchvip.com |
| Products Intro: |
Product Name:Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl-
CAS:16259-59-9
Purity:98% Package:10kgs;100kgs
|
| Company Name: |
Zhengzhou Gecko Scientific Inc.
|
| Tel: |
0371-63336364 17344886665 |
| Email: |
209932355@qq.com |
| Products Intro: |
Product Name:Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl-
CAS:16259-59-9
Purity:95LC Package:5g
|
|
| | Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl- Basic information |
| | Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl- Chemical Properties |
| Boiling point | 416.3±25.0 °C(Predicted) | | density | 1.067±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C20H18/c1-15-7-11-18(12-8-15)20(17-5-3-4-6-17)19-13-9-16(2)10-14-19/h3-14H,1-2H3 | | InChIKey | QGNPNNCBCMUAAA-UHFFFAOYSA-N | | SMILES | C(=C1C=CC=C1)(C1C=CC(C)=CC=1)C1C=CC(C)=CC=1 |
| | Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl- Usage And Synthesis |
| | Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis[4-methyl- Preparation Products And Raw materials |
|