- dA(Bz) CE Phosphoramidite
-
- $100.00 / 15kg
-
2023-03-22
- CAS:98796-53-3
- Min. Order: 0.009999999776482582kg
- Purity: 99%
- Supply Ability: 5tons
|
| Product Name: | DMT-dA(bz) Phosphoramidite | | Synonyms: | N6-Benzoyl-2'-deoxy-3'-O-DMT-adenosine 5'-CE phosphoramidite;N6-Benzoyl-2'-deoxy-5'-O-DMT-adenosine 3'-CE phosphoramidite;2'DEOXYADENOSINE PHOSPHORAMADITE;2'-DEOXYADENOSINE PHOSPHORAMIDITE;dA(N-Bz) Phosphoramidite;N-blocked-5'-O-DMT 3'-CED deoxyadenosine phosphoramidite;(2R,3S,5R)-5-(6-benzamido-9H-purin-9-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)tetrahydrofuran-3-yl 2-cyanoethyl diisopropylphosphoramidite;REF DUPL: dA(bz) Phosphoramidite | | CAS: | 98796-53-3 | | MF: | C47H52N7O7P | | MW: | 857.93 | | EINECS: | 685-521-7 | | Product Categories: | Pharmaceutical;RNAi;Amidite | | Mol File: | 98796-53-3.mol |  |
| | DMT-dA(bz) Phosphoramidite Chemical Properties |
| density | 1.23 at 20℃ | | vapor pressure | 0-0Pa at 20-50℃ | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble, clear | | form | powder or granules | | pka | 7.87±0.43(Predicted) | | color | white to off-white | | InChIKey | GGDNKEQZFSTIMJ-AKWFTNRHSA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3C(=C(N=CN=3)NC(=O)C3=CC=CC=C3)N=C2)C[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N | | LogP | 7.14 at 20℃ |
| WGK Germany | 3 | | HS Code | 29349990 |
| | DMT-dA(bz) Phosphoramidite Usage And Synthesis |
| Physical form | Powder or granules | | Color | White to off-white | | General Description |
DMT-dA(bz) Phosphoramidite belongs to the group of DNA Phosphoramidites. Its key features include:
Exocyclic amine functions are protected by a benzoyl group (dA(bz) anddC(bz)) or isobutyryl group (dG(ib)).
Recommended cleavage and deprotection conditions are 8 hours at 55 °Cor 24 hours at room temperature using concentrated ammonia solution,for standard base-protected oligonucleotides.
The high coupling efficiency of Proligo′s DNA phosphoramidites leads tohigh-yield and high-quality oligonucleotides.
| | Uses | N6-Benzoyl-2’-deoxy-5’-O-DMT-cytidine 3’-CE Phosphoramidite is used to prepare antisense oligonucleotides containing conformationally constrained methoxyaminomethylene and aminooxymethylene and aminomethylene bridged nucleoside analogs. |
| | DMT-dA(bz) Phosphoramidite Preparation Products And Raw materials |
|