|
|
| | 11β-Hydroxyandrost-4-ene-3,17-dione Basic information |
| Product Name: | 11β-Hydroxyandrost-4-ene-3,17-dione | | Synonyms: | 11beta-Hydroxy-4-androsten-3,17-dione;11-Hydroxyandrost-4-ene-3,17-dione;4-Androstene-11beta-ol-3,17-dione;Androst-4-ene-3,17-dione, 11beta-hydroxy-;Androst-4-ene-3,17-dione, 11-hydroxy-, (11beta)-;u 2826;11BETA-HYDROXY-4-ANDROSTENE-3,17-DIONE;11 BETA-HYDROXYANDROST-4-ENE-3,17-DIONE | | CAS: | 382-44-5 | | MF: | C19H26O3 | | MW: | 302.41 | | EINECS: | | | Product Categories: | Steroids | | Mol File: | 382-44-5.mol |  |
| | 11β-Hydroxyandrost-4-ene-3,17-dione Chemical Properties |
| Melting point | 197-199℃ | | Boiling point | 475.3±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 250 mg/mL (826.69 mM) | | form | A crystalline solid | | pka | 14.49±0.60(Predicted) | | color | White to off-white | | InChI | InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-15,17,21H,3-8,10H2,1-2H3/t13-,14-,15-,17+,18-,19-/m0/s1 | | InChIKey | WSCUHXPGYUMQEX-KCZNZURUSA-N | | SMILES | C1[C@@]2(C)C(CC[C@]3([H])[C@]2([H])[C@@H](O)C[C@@]2(C)[C@@]3([H])CCC2=O)=CC(=O)C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 11β-Hydroxyandrost-4-ene-3,17-dione Usage And Synthesis |
| Uses | 4-Androsten-11β-ol-3,17-dione is a steroid hormone. An analog of Androstenedione (A637550). | | Definition | ChEBI: 11beta-hydroxyandrost-4-ene-3,17-dione is an 11beta-hydroxy steroid, a 3-oxo steroid, a 17-oxo steroid and an androstanoid. It has a role as a human metabolite and a mouse metabolite. | | Biochem/physiol Actions | 11β-Hydroxy-4-androstene-3,17-dione is a naturally occurring steroid that is primarily, if not strictly, produced in adrenal tissue. In diseases such as Cushing′s syndrome, adrenal-originated hyperandrogenism, and congenital adrenal hyperplasia, plasma 11β levels are very high. Plasma 11β concentration is very low in congenital 11-hydroxylase deficiency and adrenal insufficiency. | | in vivo | The plasma concentration of 11-Beta-hydroxyandrostenedione (11beta-hydroxy-4-androstene-3,17-dione) is very high in 21-hydroxylase deficiency, Cushing's syndrome, and hyperandrogenism of adrenal origin, and very low in congenital 11-hydroxylase deficiency and adrenal insufficiency. Thus, when plasma 4-androstenedione is elevated, it is useful to measure the plasma 11-Beta-hydroxyandrostenedione level in order to determine the adrenal or ovarian origin of the hyperandrogenism[1]. | | IC 50 | Human Endogenous Metabolite |
| | 11β-Hydroxyandrost-4-ene-3,17-dione Preparation Products And Raw materials |
|