| Company Name: |
NCE Biomedical Co.,Ltd. |
| Tel: |
4000-027-021 |24 +86-13986109188 | +86-15623472865 | +81-08033611988 |
| Email: |
|
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | FW 358.2 Basic information |
| Product Name: | FW 358.2 | | Synonyms: | FW 358.2;1,1'-(2,3-Dimethyl-1,4-butanediyl)bis(3,4-dimethoxybenzene);meso-1,4-Bis(3,4-dimethoxyphenyl)dimethylbutane;Benzene, 4-[4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-1,2-dimethoxy-;4,4'-(2,3-dimethylbutane-1,4-diyl)bis(1,2-dimethoxybenzene);1,1-(2,3-Dimethyl-1,4-butanediyl)bis(3,4-dimethoxy benzene)(Nordihydroguaiaretic acid Intermediate) | | CAS: | 5701-82-6 | | MF: | C22H30O4 | | MW: | 358.47 | | EINECS: | | | Product Categories: | | | Mol File: | 5701-82-6.mol |  |
| | FW 358.2 Chemical Properties |
| Melting point | 101-102 °C | | Boiling point | 458.5±40.0 °C(Predicted) | | density | 1.036±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C22H30O4/c1-15(11-17-7-9-19(23-3)21(13-17)25-5)16(2)12-18-8-10-20(24-4)22(14-18)26-6/h7-10,13-16H,11-12H2,1-6H3 | | InChIKey | ORQFDHFZSMXRLM-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(CC(C)C(C)CC2=CC=C(OC)C(OC)=C2)C=C1OC |
| | FW 358.2 Usage And Synthesis |
| Uses | Terameprocol is a semi-synthetic lignan which inhibits the transcription of several inflammatory and oncogenic genes. |
| | FW 358.2 Preparation Products And Raw materials |
|