|
|
| | 1,2-EPOXY-5-CYCLOOCTENE Basic information |
| | 1,2-EPOXY-5-CYCLOOCTENE Chemical Properties |
| Boiling point | 195 °C(lit.) | | density | 1.013 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.495(lit.) | | Fp | 158 °F | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H12O/c1-2-4-6-8-7(9-8)5-3-1/h1-2,7-8H,3-6H2/b2-1- | | InChIKey | YWFPXWMSGJXUFS-UPHRSURJSA-N | | SMILES | C12C(O1)CCC=CCC2 |c:6| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,2-EPOXY-5-CYCLOOCTENE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 9-Oxabicyclo[6.1.0]non-4-ene may be used in the following studies:
- novel bicyclo[4.2.1] and bicyclo[3.3.1] ethers
- trans, trans-2,6-dibromo-9-oxabicyclo[3.3.1]nonane and trans, trans-2,5-dibromo-9-oxabicyclo[4.2.1]nonane
- (Z)-2-(cyclooct-4-enyloxy)acetic acid.
| | General Description | 9-Oxabicyclo[6.1.0]non-4-ene is an epoxide. It undergoes halofluorination reactions with N-halosuccinimides and triethylamine tris-hydrofluoride or Olah′s reagent. |
| | 1,2-EPOXY-5-CYCLOOCTENE Preparation Products And Raw materials |
|