ethyl 3-bromo-5-methoxybenzoate manufacturers
|
| | ethyl 3-bromo-5-methoxybenzoate Basic information |
| Product Name: | ethyl 3-bromo-5-methoxybenzoate | | Synonyms: | ethyl 3-bromo-5-methoxybenzoate;Methyl 5-bromo-m-anisate, 3-Bromo-5-(methoxycarbonyl)anisole;Benzoic acid,3-bromo-5-methoxy-, methyl ester;3-bromo-5-methoxy-ethyl benzoate | | CAS: | 56709-70-7 | | MF: | C9H9BrO3 | | MW: | 245.07 | | EINECS: | | | Product Categories: | | | Mol File: | 56709-70-7.mol |  |
| | ethyl 3-bromo-5-methoxybenzoate Chemical Properties |
| Boiling point | 288℃ | | density | 1.462 | | Fp | 128℃ | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H9BrO3/c1-12-8-4-6(9(11)13-2)3-7(10)5-8/h3-5H,1-2H3 | | InChIKey | RVXGLLDVLYTBGN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(OC)=CC(Br)=C1 |
| | ethyl 3-bromo-5-methoxybenzoate Usage And Synthesis |
| | ethyl 3-bromo-5-methoxybenzoate Preparation Products And Raw materials |
|