|
|
| | 4-Chloro-3-pyridinesulfonamide Basic information |
| Product Name: | 4-Chloro-3-pyridinesulfonamide | | Synonyms: | 4-CHLORO-3-PYRIDINESULFAMIDE;4-CHLORO-3-PYRIDINESULFONAMIDE;4-CHLORO-3-PYRIDINESULFONAMIDE HYDROCHLORIDE;4-CHLORO-3-PYRIDINESULPHONAMIDE;4-CHLORO-PYRIDINE-3-SULFONIC ACID AMIDE;4-CHLOROPYRIDINE-3-SULPHONAMIDE;4-CHOROPYRIDINE-3-SULPHONAMIDE;4-Chloropyridine-3-Sulfamide | | CAS: | 33263-43-3 | | MF: | C5H5ClN2O2S | | MW: | 192.62 | | EINECS: | 251-434-4 | | Product Categories: | Pyridines;SULFONAMIDE | | Mol File: | 33263-43-3.mol |  |
| | 4-Chloro-3-pyridinesulfonamide Chemical Properties |
| Melting point | 150-155 °C | | Boiling point | 380.4±52.0 °C(Predicted) | | density | 1.558±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.01±0.60(Predicted) | | color | Pale Yellow to Yellow | | Water Solubility | soluble | | InChI | InChI=1S/C5H5ClN2O2S/c6-4-1-2-8-3-5(4)11(7,9)10/h1-3H,(H2,7,9,10) | | InChIKey | DGIINIBYHCODIH-UHFFFAOYSA-N | | SMILES | C1=NC=CC(Cl)=C1S(N)(=O)=O | | CAS DataBase Reference | 33263-43-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 36/37 | | RIDADR | 2811 | | PackingGroup | III | | HS Code | 29333999 |
| | 4-Chloro-3-pyridinesulfonamide Usage And Synthesis |
| Chemical Properties | off-white to light beige powder | | Uses | 4-Chloro-3-pyridinesulfonamide is a building block that has been used as a reactant for the preparation of heterocyclic 4-substituted pyridine-3-sulfonamide derivatives as inhibitors of four isoforms of zinc enzyme carbonic anhydrase. |
| | 4-Chloro-3-pyridinesulfonamide Preparation Products And Raw materials |
|