|
|
| | Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester Basic information |
| Product Name: | Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester | | Synonyms: | Methyl 4-(1-aMinocyclopropyl)benzoate hydrochloride;4-(1-AMinocyclopropyl)benzoic acid Methyl ester hydrochloride;4-(1-Amino-cyclopropyl)-benzoic acid methyl ester;Methyl 4-(1-aminocyclopropyl)benzoate;Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester;METHYL 4-(AMINOCYCLOPROPYL)BENZOATE;METHYL 4-(1-AMINOCYCLOPROPYL)BENZATE | | CAS: | 1006037-03-1 | | MF: | C11H13NO2 | | MW: | 191.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1006037-03-1.mol |  |
| | Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester Chemical Properties |
| Melting point | 49.6-50.4 °C | | Boiling point | 297.5±33.0 °C(Predicted) | | density | 1.185±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 7.38±0.20(Predicted) | | form | solid | | color | Light yellow to yellow | | InChI | InChI=1S/C11H13NO2/c1-14-10(13)8-2-4-9(5-3-8)11(12)6-7-11/h2-5H,6-7,12H2,1H3 | | InChIKey | JUMQWXLIAYMPHT-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(C2(N)CC2)C=C1 |
| | Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester Usage And Synthesis |
| | Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester Preparation Products And Raw materials |
|