- Cetyl chloroformate
-
- $1.00 / 1kg
-
2019-07-06
- CAS:26272-90-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: Customized
|
| | Cetyl chloroformate Basic information |
| Product Name: | Cetyl chloroformate | | Synonyms: | Hexadecyl carbonochloridate;carbonochloridicacid,hexadecylester;CETYL CHLOROFORMATE;CHLOROFORMIC ACID CETYL ESTER;CHLOROFORMIC ACID HEXADECYL ESTER;CHLOROFORMIC ACID N-HEXADECYL ESTER;HEXADECYL CHLOROCARBONATE;HEXADECYL CHLOROFORMATE | | CAS: | 26272-90-2 | | MF: | C17H33ClO2 | | MW: | 304.9 | | EINECS: | 247-578-2 | | Product Categories: | | | Mol File: | 26272-90-2.mol |  |
| | Cetyl chloroformate Chemical Properties |
| Melting point | 14 °C | | Boiling point | 367.1±11.0 °C(Predicted) | | density | 0.923 g/mL at 25 °C(lit.) | | vapor pressure | 10Pa at 20℃ | | refractive index | n20/D 1.4480(lit.) | | Fp | >230 °F | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C17H33ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17(18)19/h2-16H2,1H3 | | InChIKey | HOQUWXSARQBQCW-UHFFFAOYSA-N | | SMILES | C(Cl)(OCCCCCCCCCCCCCCCC)=O | | CAS DataBase Reference | 26272-90-2(CAS DataBase Reference) | | EPA Substance Registry System | Carbonochloridic acid, hexadecyl ester (26272-90-2) |
| Hazard Codes | C | | Risk Statements | 34-43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | HazardClass | 6.1/8 | | PackingGroup | II | | HS Code | 29159000 |
| | Cetyl chloroformate Usage And Synthesis |
| Uses | Cetyl chloroformate combined with modified cellulose nanocrystals contributes to improving the catalytic performance of Candida albicans lipase B (CALB). | | Flammability and Explosibility | Non flammable |
| | Cetyl chloroformate Preparation Products And Raw materials |
|