3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt manufacturers
|
| | 3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt Basic information |
| Product Name: | 3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt | | Synonyms: | Taurolithocholic Acid Sulfate Disodium Salt;3α-Hydroxy-5β-cholan-24-oic acid n-(2-sulfoethyl)amide 3-sulfate disodium salt;TAUROLITHOCHOLIC ACID 3-SULFATE DISODIUM SALT;taurolithocholic acid 3-sulfate*disodium;3α-hydroxy-5β-cholan-24-oic acid n-(2-sulfoethyl)amide 3-sulfate;Taurolithocholic Acid 3-sulfate (sodium salt);TAUROLITHOCHOLIC ACID 3-SULFATE*DISO;disodium:2-[[(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-sulfonatooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate | | CAS: | 64936-83-0 | | MF: | C26H43NNa2O8S2 | | MW: | 607.73 | | EINECS: | | | Product Categories: | | | Mol File: | 64936-83-0.mol | ![3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt Structure](CAS/GIF/64936-83-0.gif) |
| | 3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt Chemical Properties |
| Melting point | >195°C (dec.) | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | YHTVOGLKSGJIDL-DCDZWGCSNA-L | | SMILES | [Na].[H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCC(=O)NCCS(O)(=O)=O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@H](C2)OS(O)(=O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt Usage And Synthesis |
| Uses | Disodium salt of Taurolithocholic Acid Sulfate, a metabolite of bile acids. Sulfation is a major metabolic pathway involved in the elimination and detoxification of bile acids (BAs). | | Uses | Taurolithocholic acid 3-sulfate disodium salt has been used in a study to assess the electrophysiological effects of bile acids on pancreatic acinar cells. It has also been used in a study to investigate the mechanisms underlying the inhibition of bile acid-induced apoptosis by cyclic AMP in rat hepatocytes. | | General Description | Taurolithocholic acid 3-sulfate disodium salt is a natural detergent bile salt with potential use as a topical microbicidal agent. |
| | 3alpha-Hydroxy-5beta-cholan-24-oic acid N-[2-sulfoethyl]amide 3-sulfate disodium salt Preparation Products And Raw materials |
|