- Matairesinol
-
- $1.10 / 1g
-
2025-11-18
- CAS:580-72-3
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons Min
- Matairesinol
-
- $0.00 / 5mg
-
2023-02-24
- CAS:580-72-3
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- MATAIRESINOL
-
- $1.00 / 1KG
-
2020-01-05
- CAS:580-72-3
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | MATAIRESINOL Basic information |
| Product Name: | MATAIRESINOL | | Synonyms: | (αR,βR)-α,β-Bis(4-hydroxy-3-methoxybenzyl)butyrolactone;(3R)-3α,4β-Bis(3-methoxy-4-hydroxybenzyl)-4,5-dihydrofuran-2(3H)-one;(3R)-3α,4β-Bis(4-hydroxy-3-methoxybenzyl)tetrahydrofuran-5-one;(3R,4R)-3,4-Bis(3-methoxy-4-hydroxybenzyl)tetrahydrofuran-2-one;(3R,4R)-4,5-Dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one;(3R,4R)-3,4-bis(4-hydroxy-3-methoxy-benzyl)tetrahydrofuran-2-one;(3R,4R)-3,4-bis[(4-hydroxy-3-methoxy-phenyl)methyl]oxolan-2-one;(3R,4R)-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one | | CAS: | 580-72-3 | | MF: | C20H22O6 | | MW: | 358.39 | | EINECS: | 200-258-5 | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 580-72-3.mol |  |
| | MATAIRESINOL Chemical Properties |
| Melting point | 119～120℃ | | Boiling point | 593.0±45.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | FEMA | 4762 | (-)-MATAIRESINOL | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | White to off-white solid. | | pka | 10.02±0.20(Predicted) | | color | White to Off-White | | JECFA Number | 2210 | | BRN | 7826317 | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1 | | InChIKey | MATGKVZWFZHCLI-LSDHHAIUSA-N | | SMILES | O1C[C@H](CC2=CC=C(O)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O | | LogP | 1.655 (est) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | MATAIRESINOL Usage And Synthesis |
| Uses | Matairesinol is a principle plant lignan consituent of dietary fiber. | | Definition | ChEBI: (-)-matairesinol is a lignan that is gamma-butyrolactone in which the 3 and 4 positions are substituted by 4-hydroxy-3-methoxybenzyl groups (the 3R,4R-diastereomer). It has a role as a phytoestrogen, a plant metabolite, an angiogenesis inhibitor and an anti-asthmatic agent. It is a polyphenol, a lignan and a gamma-lactone. |
| | MATAIRESINOL Preparation Products And Raw materials |
|