|
|
| | COBALT(II) ACETYLACETONATE Basic information |
| | COBALT(II) ACETYLACETONATE Chemical Properties |
| Melting point | 165-170 °C(lit.) | | storage temp. | Store at room temperature | | solubility | very faint turbidity in hot Chloroform | | form | Powder | | color | pink | | InChI | 1S/2C5H8O2.Co.H2O/c2*1-4(6)3-5(2)7;;/h2*3,6H,1-2H3;;1H2/q;;+2;/p-2/b2*4-3-;; | | InChIKey | CCSRIPNIKKQYHL-SUKNRPLKSA-L | | SMILES | O.CC(=O)\C=C(\C)O[Co]O\C(C)=C/C(C)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-41-40 | | Safety Statements | 7-22-26-37/39 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2931.90.9051 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Eye Dam. 1 Repr. 1A Resp. Sens. 1 Skin Sens. 1 |
| | COBALT(II) ACETYLACETONATE Usage And Synthesis |
| reaction suitability | core: cobalt | | Purification Methods | Recrystallise it from acetone or MeOH and dry it in a vacuum. [Beilstein 1 H 783.] |
| | COBALT(II) ACETYLACETONATE Preparation Products And Raw materials |
|